| Name | 3-Ethoxypropionaldehyde diethyl acetal |
| Synonyms | 1,1,3-TRIETHOXYPROPANE 1,1,3-Triethoxypropane Propane, 1,1,3-triethoxy- 3-Ethoxypropanal diethyl acetal 3-ETHOXYPROPANAL DIETHYL ACETAL 3-ETHOXYPROPIONALDEHYDE DIETHYL ACETAL 3-Ethoxypropionaldehyde diethyl acetal B-ETHOXYPROPIONALDEHYDE, DIETHYL ACETAL 3-Ethoxy propionaldehyde diethyl acetal 3-Ethoxypropionaldehyde diethyl acetal Propane 3-Ethoxypropanal diethyl acetal~3-Ethoxypropionaldehyde diethyl acetal |
| CAS | 7789-92-6 |
| EINECS | 232-193-4 |
| InChI | InChI=1/C9H20O3/c1-4-10-8-7-9(11-5-2)12-6-3/h9H,4-8H2,1-3H3 |
| Molecular Formula | C9H20O3 |
| Molar Mass | 176.25 |
| Density | 0.898g/mLat 25°C(lit.) |
| Boling Point | 184-186°C(lit.) |
| Flash Point | 128°F |
| Vapor Presure | 0.976mmHg at 25°C |
| BRN | 1098506 |
| Storage Condition | Flammables area |
| Refractive Index | n20/D 1.406(lit.) |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R10 - Flammable R22 - Harmful if swallowed R2017/10/22 - |
| Safety Description | S16 - Keep away from sources of ignition. S36 - Wear suitable protective clothing. |
| UN IDs | UN 3271 3/PG 3 |
| WGK Germany | 3 |
| RTECS | TZ9450000 |
| HS Code | 29110000 |
| Hazard Class | 3 |
| Packing Group | III |
| Toxicity | LD50 orl-rat: 1600 mg/kg AMIHBC 4,119,51 |
| category | flammable liquid |
| toxicity classification | poisoning |
| acute toxicity | oral-rat LD50: 1600 mg/kg |
| stimulation data | skin-rabbit 10 mg/24 hours mild; Eye-rabbit 750 mg |
| flammability hazard characteristics | combustible in case of open flame, high temperature and strong oxidant; Combustion emission stimulates smoke |
| storage and transportation characteristics | complete packaging, light and light; warehouse ventilation, away from open flames, high temperature, separate storage from oxidant |
| fire extinguishing agent | foam, carbon dioxide, dry powder, sand |